5965-53-7 Diethyl oxalpropionate
Naam product |
Diethyl oxalpropionate |
Engelse naam |
Diethyl oxalpropionate; Diethyl 2-methyl-2-oxosuccinate; Diethyl oxalpropionate;
; diethyl 2-oxopentanedioate; ethyl propyl carbonate |
MF |
C6H12O3 |
Molecuulgewicht |
132.1577 |
InChI |
InChI=1/C6H12O3/c1-3-5-9-6(7)8-4-2/h3-5H2,1-2H3 |
CAS-nummer |
5965-53-7 |
EINECS |
227-750-3 |
Moleculaire Structuur |
|
Dichtheid |
0.961g/cm3 |
Kookpunt |
139.3°C at 760 mmHg |
Brekingsindex |
1.4 |
Vlampunt |
48.3°C |
Dampdruk |
6.46mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|