ChemNet > CAS > 603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%)
603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%)
Naam product |
2,3,6-trinitrophenol moistened with water (H2O ~40%) |
Engelse naam |
2,3,6-trinitrophenol moistened with water (H2O ~40%); |
MF |
C6H3N3O7 |
Molecuulgewicht |
229.1039 |
InChI |
InChI=1/C6H3N3O7/c10-6-4(8(13)14)2-1-3(7(11)12)5(6)9(15)16/h1-2,10H |
CAS-nummer |
603-10-1 |
Moleculaire Structuur |
|
Dichtheid |
1.856g/cm3 |
Smeltpunt |
119-120℃ |
Kookpunt |
337.9°C at 760 mmHg |
Brekingsindex |
1.701 |
Vlampunt |
151.1°C |
Dampdruk |
5.2E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|