606-27-9 Methyl 2-nitrobenzoate
Naam product |
Methyl 2-nitrobenzoate |
Engelse naam |
Methyl 2-nitrobenzoate; 2-Nitrobenzoic acid methyl ester |
MF |
C8H7NO4 |
Molecuulgewicht |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
CAS-nummer |
606-27-9 |
EINECS |
210-111-8 |
Moleculaire Structuur |
|
Dichtheid |
1.301g/cm3 |
Smeltpunt |
-13℃ |
Kookpunt |
275°C at 760 mmHg |
Brekingsindex |
1.553 |
Vlampunt |
124.8°C |
Dampdruk |
0.00523mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|