608-73-1 BHC of HCH
Naam product |
BHC of HCH |
Synoniemen |
; benzeenhexachloride; 1,2,3,4,5,6-hexachloorcyclohexaan |
Engelse naam |
BHC or HCH; benzene hexachloride; 1,2,3,4,5,6-hexachlorocyclohexane |
MF |
C6H6Cl6 |
Molecuulgewicht |
290.8298 |
InChI |
InChI=1/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H |
CAS-nummer |
608-73-1 |
EINECS |
210-168-9 |
Moleculaire Structuur |
|
Dichtheid |
1.59g/cm3 |
Kookpunt |
288°C at 760 mmHg |
Brekingsindex |
1.532 |
Vlampunt |
157.5°C |
Dampdruk |
0.00416mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|