ChemNet > CAS > 61-47-2 Serotonine-creatininesulfaat-monohydraat
61-47-2 Serotonine-creatininesulfaat-monohydraat
| Naam product |
Serotonine-creatininesulfaat-monohydraat |
| Synoniemen |
5-Hydroxytryptamine creatininesulfaat monohydraat; 2-(2-aminoethyl)indool-5-ol 2-imino-1-methylimidazoline-4-onsulfaat; 2-amino-1-methyl-4-oxo-4,5-dihydro-1H-imidazool-1-ium 2-(5-hydroxy-1H-indol-3-yl)ethanaminiumsulfaat (1:1:1); 3-(2-aminoethyl)-1H-indol-5-ol; 2-amino-1-methyl-5H-imidazool-4-on; zwavelzuur; hydraat; 2-(5-hydroxy-1H-indol-3-yl)ethanaminium |
| Engelse naam |
Serotonin creatinine sulfate monohydrate; 5-Hydroxytryptamine creatinine sulfate monohydrate; 2-(2-aminoethyl)indole-5-ol 2-imino-1-methylimidazoline-4-one sulphate; 2-amino-1-methyl-4-oxo-4,5-dihydro-1H-imidazol-1-ium 2-(5-hydroxy-1H-indol-3-yl)ethanaminium sulfate (1:1:1); 3-(2-aminoethyl)-1H-indol-5-ol; 2-amino-1-methyl-5H-imidazol-4-one; sulfuric acid; hydrate; 2-(5-hydroxy-1H-indol-3-yl)ethanaminium |
| MF |
C10H13N2O |
| Molecuulgewicht |
177.2225 |
| InChI |
InChI=1/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2/p+1 |
| CAS-nummer |
61-47-2 |
| EINECS |
213-539-3 |
| Moleculaire Structuur |
|
| Smeltpunt |
216-219℃ |
| Kookpunt |
416.1°C at 760 mmHg |
| Vlampunt |
205.4°C |
| Dampdruk |
1.63E-07mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R40:Possible risks of irreversible effects.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
