613-03-6 1,2,4-Triacetoxybenzene
Naam product |
1,2,4-Triacetoxybenzene |
Engelse naam |
1,2,4-Triacetoxybenzene; 1,2,4-Phenenyl triacetate; benzene-1,2,4-triyl triacetate; 2-[(1-hydroxyethenyl)oxy]benzene-1,4-diyl diacetate |
MF |
C12H12O6 |
Molecuulgewicht |
252.2201 |
InChI |
InChI=1/C12H12O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-6,15H,3H2,1-2H3 |
CAS-nummer |
613-03-6 |
EINECS |
210-327-2 |
Moleculaire Structuur |
|
Dichtheid |
1.276g/cm3 |
Smeltpunt |
98-100℃ |
Kookpunt |
401°C at 760 mmHg |
Brekingsindex |
1.533 |
Vlampunt |
153.2°C |
Dampdruk |
3.77E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|