ChemNet > CAS > 61439-59-6 2-(4-Benzyloxyphenyl)ethanol
61439-59-6 2-(4-Benzyloxyphenyl)ethanol
| Naam product |
2-(4-Benzyloxyphenyl)ethanol |
| Engelse naam |
2-(4-Benzyloxyphenyl)ethanol; p-Benzyloxyphenethyl alcohol |
| MF |
C15H16O2 |
| Molecuulgewicht |
228.2863 |
| InChI |
InChI=1/C15H16O2/c16-11-10-13-6-8-15(9-7-13)17-12-14-4-2-1-3-5-14/h1-9,16H,10-12H2 |
| CAS-nummer |
61439-59-6 |
| EINECS |
262-795-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.116g/cm3 |
| Kookpunt |
379.1°C at 760 mmHg |
| Brekingsindex |
1.584 |
| Vlampunt |
170.1°C |
| Dampdruk |
2.02E-06mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
