ChemNet > CAS > 617-05-0 Vanilicacidethylester; 97%
617-05-0 Vanilicacidethylester; 97%
Naam product |
Vanilicacidethylester; 97% |
Engelse naam |
Vanilicacidethylester; 97%; Vanilic acid ethyl ester; Ethyl vanillate; Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester; 4-Hydroxy-3-methoxybenzoic acid ethyl ester; ethyl 4-hydroxy-3-methoxybenzoate |
MF |
C10H12O4 |
Molecuulgewicht |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 |
CAS-nummer |
617-05-0 |
EINECS |
210-503-9 |
Moleculaire Structuur |
|
Dichtheid |
1.18g/cm3 |
Smeltpunt |
39-41℃ |
Kookpunt |
292°C at 760 mmHg |
Brekingsindex |
1.528 |
Vlampunt |
122.4°C |
Dampdruk |
0.00108mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|