ChemNet > CAS > 618-71-3 Ethyl 3,5-dinitrobenzoate
618-71-3 Ethyl 3,5-dinitrobenzoate
Naam product |
Ethyl 3,5-dinitrobenzoate |
Engelse naam |
Ethyl 3,5-dinitrobenzoate; 3,5-Dinitrobenzoic acid ethyl ester |
MF |
C9H8N2O6 |
Molecuulgewicht |
240.1696 |
InChI |
InChI=1/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 |
CAS-nummer |
618-71-3 |
EINECS |
210-559-4 |
Moleculaire Structuur |
|
Dichtheid |
1.433g/cm3 |
Smeltpunt |
94-95℃ |
Kookpunt |
367.1°C at 760 mmHg |
Brekingsindex |
1.58 |
Vlampunt |
171.8°C |
Dampdruk |
1.39E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|