ChemNet > CAS > 619-31-8 N,N-Dimethyl-3-nitroaniline
619-31-8 N,N-Dimethyl-3-nitroaniline
| Naam product |
N,N-Dimethyl-3-nitroaniline |
| Engelse naam |
N,N-Dimethyl-3-nitroaniline; 3-Nitro-N,N-dimethylaniline; Benzenamine, N,N-dimethyl-3-nitro- |
| MF |
C8H10N2O2 |
| Molecuulgewicht |
166.1772 |
| InChI |
InChI=1/C8H10N2O2/c1-9(2)7-4-3-5-8(6-7)10(11)12/h3-6H,1-2H3 |
| CAS-nummer |
619-31-8 |
| EINECS |
210-590-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.193g/cm3 |
| Smeltpunt |
57-61℃ |
| Kookpunt |
282.5°C at 760 mmHg |
| Brekingsindex |
1.591 |
| Vlampunt |
117°C |
| Dampdruk |
0.00334mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
