ChemNet > CAS > 620-79-1 Ethyl 2-benzylacetoacetate
620-79-1 Ethyl 2-benzylacetoacetate
| Naam product |
Ethyl 2-benzylacetoacetate |
| Engelse naam |
Ethyl 2-benzylacetoacetate; 2-Benzylacetoacetic acid ethyl ester; ethyl 2-benzyl-3-oxobutanoate; ethyl (2S)-2-benzyl-3-oxobutanoate; ethyl (2R)-2-benzyl-3-oxobutanoate; Ethyl-2-benzylacetoacetate; Ethyl 2-acetyl-3-phenylpropionate |
| MF |
C13H16O3 |
| Molecuulgewicht |
220.2643 |
| InChI |
InChI=1/C13H16O3/c1-3-16-13(15)12(10(2)14)9-11-7-5-4-6-8-11/h4-8,12H,3,9H2,1-2H3/t12-/m1/s1 |
| CAS-nummer |
620-79-1 |
| EINECS |
210-651-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.07g/cm3 |
| Kookpunt |
276°C at 760 mmHg |
| Brekingsindex |
1.502 |
| Vlampunt |
132.3°C |
| Dampdruk |
0.00493mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
