621-04-5 1-ethyl-3-fenylureum
Naam product |
1-ethyl-3-fenylureum |
Synoniemen |
N-ethyl-N-fenylureum |
Engelse naam |
1-Ethyl-3-phenylurea; N-Ethyl-N-phenylurea |
MF |
C9H12N2O |
Molecuulgewicht |
164.2044 |
InChI |
InChI=1/C9H12N2O/c1-2-10-9(12)11-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H2,10,11,12) |
CAS-nummer |
621-04-5 |
Moleculaire Structuur |
|
Dichtheid |
1.11g/cm3 |
Kookpunt |
250.2°C at 760 mmHg |
Brekingsindex |
1.573 |
Vlampunt |
102°C |
Dampdruk |
0.0219mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|