ChemNet > CAS > 621-54-5 3-(3-Hydroxyphenyl)propionic acid
621-54-5 3-(3-Hydroxyphenyl)propionic acid
| Naam product |
3-(3-Hydroxyphenyl)propionic acid |
| Engelse naam |
3-(3-Hydroxyphenyl)propionic acid; 3-Hydroxyhydrocinnamic acid; 3-Hydroxyphenyl-propionic acid; 3-(3-hydroxyphenyl)propanoic acid |
| MF |
C9H10O3 |
| Molecuulgewicht |
166.1739 |
| InChI |
InChI=1/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12) |
| CAS-nummer |
621-54-5 |
| EINECS |
210-692-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.26g/cm3 |
| Kookpunt |
354.5°C at 760 mmHg |
| Brekingsindex |
1.58 |
| Vlampunt |
182.4°C |
| Dampdruk |
1.23E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
