ChemNet > CAS > 62476-62-4 Alpha,Alpha,2-Trichloro-6-fluorotoluene
62476-62-4 Alpha,Alpha,2-Trichloro-6-fluorotoluene
| Naam product |
Alpha,Alpha,2-Trichloro-6-fluorotoluene |
| Engelse naam |
Alpha,Alpha,2-Trichloro-6-fluorotoluene; 2-Chloro-6-fluorobenzalchloride; 1-chloro-2-(dichloromethyl)-3-fluorobenzene |
| MF |
C7H4Cl3F |
| Molecuulgewicht |
213.4641 |
| InChI |
InChI=1/C7H4Cl3F/c8-4-2-1-3-5(11)6(4)7(9)10/h1-3,7H |
| CAS-nummer |
62476-62-4 |
| EINECS |
263-562-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.467g/cm3 |
| Kookpunt |
225.4°C at 760 mmHg |
| Brekingsindex |
1.541 |
| Vlampunt |
99.7°C |
| Dampdruk |
0.129mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
