ChemNet > CAS > 62484-76-8 5,7-dimethylchromon-3-carboxaldehyde
62484-76-8 5,7-dimethylchromon-3-carboxaldehyde
| Naam product |
5,7-dimethylchromon-3-carboxaldehyde |
| Synoniemen |
5,7-dimethyl-4-oxo-4H-chroom-3-carbaldehyde |
| Engelse naam |
5,7-Dimethylchromone-3-carboxaldehyde;5,7-dimethyl-4-oxo-4H-chromene-3-carbaldehyde |
| MF |
C12H10O3 |
| Molecuulgewicht |
202.206 |
| InChI |
InChI=1/C12H10O3/c1-7-3-8(2)11-10(4-7)15-6-9(5-13)12(11)14/h3-6H,1-2H3 |
| CAS-nummer |
62484-76-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.311g/cm3 |
| Kookpunt |
362.7°C at 760 mmHg |
| Brekingsindex |
1.646 |
| Vlampunt |
163.2°C |
| Dampdruk |
1.9E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
