6267-24-9 Tris(ethylthio)methane
Naam product |
Tris(ethylthio)methane |
Engelse naam |
Tris(ethylthio)methane; Ethyl orthothioformate~Triethyl trithioorthoformate; {[bis(ethylsulfanyl)methyl]sulfanyl}ethane |
MF |
C7H16S3 |
Molecuulgewicht |
196.3969 |
InChI |
InChI=1/C7H16S3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3 |
CAS-nummer |
6267-24-9 |
EINECS |
228-439-5 |
Moleculaire Structuur |
|
Dichtheid |
1.053g/cm3 |
Kookpunt |
269.2°C at 760 mmHg |
Brekingsindex |
1.539 |
Vlampunt |
111.3°C |
Dampdruk |
0.0122mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|