627-04-3 (Ethylthio)acetic acid
Naam product |
(Ethylthio)acetic acid |
Engelse naam |
(Ethylthio)acetic acid; S-Ethylthioglycolic acid; (ethylsulfanyl)acetic acid |
MF |
C4H8O2S |
Molecuulgewicht |
120.1701 |
InChI |
InChI=1/C4H8O2S/c1-2-7-3-4(5)6/h2-3H2,1H3,(H,5,6) |
CAS-nummer |
627-04-3 |
EINECS |
210-979-8 |
Moleculaire Structuur |
|
Dichtheid |
1.164g/cm3 |
Kookpunt |
229°C at 760 mmHg |
Brekingsindex |
1.496 |
Vlampunt |
92.3°C |
Dampdruk |
0.0254mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|