627-90-7 ethyl undecanoate
Naam product |
ethyl undecanoate |
Engelse naam |
ethyl undecanoate; Undecanoic acid ethyl ester; Undecanoic acid-ethyl ester |
MF |
C13H26O2 |
Molecuulgewicht |
214.3443 |
InChI |
InChI=1/C13H26O2/c1-3-5-6-7-8-9-10-11-12-13(14)15-4-2/h3-12H2,1-2H3 |
CAS-nummer |
627-90-7 |
EINECS |
211-018-5 |
Moleculaire Structuur |
|
Dichtheid |
0.869g/cm3 |
Smeltpunt |
-15℃ |
Kookpunt |
258.4°C at 760 mmHg |
Brekingsindex |
1.432 |
Vlampunt |
109.5°C |
Dampdruk |
0.0137mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|