ChemNet > CAS > 6276-04-6 1-iodo-3,5-dinitrobenzene
6276-04-6 1-iodo-3,5-dinitrobenzene
| Naam product |
1-iodo-3,5-dinitrobenzene |
| Engelse naam |
1-iodo-3,5-dinitrobenzene; |
| MF |
C6H3IN2O4 |
| Molecuulgewicht |
294.0035 |
| InChI |
InChI=1/C6H3IN2O4/c7-4-1-5(8(10)11)3-6(2-4)9(12)13/h1-3H |
| CAS-nummer |
6276-04-6 |
| Moleculaire Structuur |
|
| Dichtheid |
2.174g/cm3 |
| Smeltpunt |
108-111℃ |
| Kookpunt |
346°C at 760 mmHg |
| Brekingsindex |
1.699 |
| Vlampunt |
163.1°C |
| Dampdruk |
0.000118mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R42/43:May cause sensitization by inhalation and skin contact.;
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24:Avoid contact with skin.;
S37:Wear suitable gloves.;
|
|
