ChemNet > CAS > 6290-17-1 Ethyl acetoacetate propylene glycol ketal
6290-17-1 Ethyl acetoacetate propylene glycol ketal
Naam product |
Ethyl acetoacetate propylene glycol ketal |
Engelse naam |
Ethyl acetoacetate propylene glycol ketal; 2,4-Dimethyl-1,3-dioxolane-2-acetic acid ethyl ester~Ethyl 2,4-dimethyl-1,3-dioxolane-2-acetate; Acetoacetic acid ethyl ester 1,2-propylene ketal; ethyl (2,4-dimethyl-1,3-dioxolan-2-yl)acetate |
MF |
C9H16O4 |
Molecuulgewicht |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-4-11-8(10)5-9(3)12-6-7(2)13-9/h7H,4-6H2,1-3H3 |
CAS-nummer |
6290-17-1 |
EINECS |
228-536-2 |
Moleculaire Structuur |
|
Dichtheid |
1.026g/cm3 |
Kookpunt |
220.6°C at 760 mmHg |
Brekingsindex |
1.423 |
Vlampunt |
86.8°C |
Dampdruk |
0.112mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|