ChemNet > CAS > 6306-07-6 1-Acenaphthenol
6306-07-6 1-Acenaphthenol
| Naam product |
1-Acenaphthenol |
| Engelse naam |
1-Acenaphthenol; |
| MF |
C12H10O |
| Molecuulgewicht |
170.2072 |
| InChI |
InChI=1/C12H10O/c13-11-7-9-5-1-3-8-4-2-6-10(11)12(8)9/h1-6,11,13H,7H2/t11-/m1/s1 |
| CAS-nummer |
6306-07-6 |
| EINECS |
228-618-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.29g/cm3 |
| Smeltpunt |
147-148℃ |
| Kookpunt |
369.2°C at 760 mmHg |
| Brekingsindex |
1.741 |
| Vlampunt |
129°C |
| Dampdruk |
4.2E-06mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
