632-22-4 1,1,3,3-Tetramethylurea
Naam product |
1,1,3,3-Tetramethylurea |
Engelse naam |
1,1,3,3-Tetramethylurea; Tetramethylurea |
MF |
C5H12N2O |
Molecuulgewicht |
116.16 |
InChI |
InChI=1/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3 |
CAS-nummer |
632-22-4 |
EINECS |
211-173-9 |
Moleculaire Structuur |
|
Dichtheid |
0.9879 |
Smeltpunt |
-1℃ |
Kookpunt |
174-178℃ |
Brekingsindex |
1.4496-1.4516 |
Vlampunt |
65℃ |
Oplosbaarheid in water |
miscible |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R22:;
|
Veiligheid Omschrijving |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|