ChemNet > CAS > 6326-44-9 Diethyl formamidomalonate
6326-44-9 Diethyl formamidomalonate
Naam product |
Diethyl formamidomalonate |
Engelse naam |
Diethyl formamidomalonate; Formamidomalonic acid diethyl ester; diethyl (formylamino)propanedioate; Diethylformamidomalonate |
MF |
C8H13NO5 |
Molecuulgewicht |
203.1925 |
InChI |
InChI=1/C8H13NO5/c1-3-13-7(11)6(9-5-10)8(12)14-4-2/h5-6H,3-4H2,1-2H3,(H,9,10) |
CAS-nummer |
6326-44-9 |
EINECS |
228-692-1 |
Moleculaire Structuur |
|
Dichtheid |
1.167g/cm3 |
Smeltpunt |
51-56℃ |
Kookpunt |
316.8°C at 760 mmHg |
Brekingsindex |
1.445 |
Vlampunt |
165.7°C |
Dampdruk |
0.0004mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|