ChemNet > CAS > 636-70-4 Triethylamine hydrobromide
636-70-4 Triethylamine hydrobromide
Naam product |
Triethylamine hydrobromide |
Engelse naam |
Triethylamine hydrobromide; triethylammonium bromide |
MF |
C6H15N.HBr |
Molecuulgewicht |
182.10 |
InChI |
InChI=1/C6H15N.BrH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
CAS-nummer |
636-70-4 |
EINECS |
211-263-8 |
Moleculaire Structuur |
|
Smeltpunt |
246-248℃ |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|