ChemNet > CAS > 64-65-3 Bemegride
64-65-3 Bemegride
| Naam product |
Bemegride |
| Engelse naam |
Bemegride; 3-Ethyl-3-methylglutarimide; 4-Ethyl-4-methyl-2,6-piperidinedione; 3-Methyl-3-ethylglutarimide; 4-ethyl-4-methylpiperidine-2,6-dione |
| MF |
C8H13NO2 |
| Molecuulgewicht |
155.1943 |
| InChI |
InChI=1/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
| CAS-nummer |
64-65-3 |
| EINECS |
200-588-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.024g/cm3 |
| Smeltpunt |
126-129℃ |
| Kookpunt |
282°C at 760 mmHg |
| Brekingsindex |
1.448 |
| Vlampunt |
125.8°C |
| Dampdruk |
0.00344mmHg at 25°C |
| Gevaarsymbolen |
 T:Toxic;
|
| Risico-codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
