64-65-3 Bemegride
Naam product |
Bemegride |
Engelse naam |
Bemegride; 3-Ethyl-3-methylglutarimide; 4-Ethyl-4-methyl-2,6-piperidinedione; 3-Methyl-3-ethylglutarimide; 4-ethyl-4-methylpiperidine-2,6-dione |
MF |
C8H13NO2 |
Molecuulgewicht |
155.1943 |
InChI |
InChI=1/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
CAS-nummer |
64-65-3 |
EINECS |
200-588-0 |
Moleculaire Structuur |
|
Dichtheid |
1.024g/cm3 |
Smeltpunt |
126-129℃ |
Kookpunt |
282°C at 760 mmHg |
Brekingsindex |
1.448 |
Vlampunt |
125.8°C |
Dampdruk |
0.00344mmHg at 25°C |
Gevaarsymbolen |
T:Toxic;
|
Risico-codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|