ChemNet > CAS > 64123-77-9 Methyl 3-fluorophenylacetate
64123-77-9 Methyl 3-fluorophenylacetate
Naam product |
Methyl 3-fluorophenylacetate |
Engelse naam |
Methyl 3-fluorophenylacetate; |
MF |
C9H9FO2 |
Molecuulgewicht |
168.165 |
InChI |
InChI=1/C9H9FO2/c1-12-9(11)6-7-3-2-4-8(10)5-7/h2-5H,6H2,1H3 |
CAS-nummer |
64123-77-9 |
Moleculaire Structuur |
|
Dichtheid |
1.148g/cm3 |
Kookpunt |
204°C at 760 mmHg |
Brekingsindex |
1.488 |
Vlampunt |
75.3°C |
Dampdruk |
0.27mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|