ChemNet > CAS > 64218-50-4 2-chloor-1-(4,5-dichloor-2-thienyl)ethan-1-on
64218-50-4 2-chloor-1-(4,5-dichloor-2-thienyl)ethan-1-on
Naam product |
2-chloor-1-(4,5-dichloor-2-thienyl)ethan-1-on |
Synoniemen |
2-chloor-1-(4,5-dichloorthiofeen-2-yl)ethon |
Engelse naam |
2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one;2-chloro-1-(4,5-dichlorothiophen-2-yl)ethanone |
MF |
C6H3Cl3OS |
Molecuulgewicht |
229.5114 |
InChI |
InChI=1/C6H3Cl3OS/c7-2-4(10)5-1-3(8)6(9)11-5/h1H,2H2 |
CAS-nummer |
64218-50-4 |
Moleculaire Structuur |
|
Dichtheid |
1.574g/cm3 |
Smeltpunt |
56℃ |
Kookpunt |
355.8°C at 760 mmHg |
Brekingsindex |
1.591 |
Vlampunt |
169°C |
Dampdruk |
3.05E-05mmHg at 25°C |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|