ChemNet > CAS > 6484-25-9 4-chloor-2-fenylquinazoline
6484-25-9 4-chloor-2-fenylquinazoline
Naam product |
4-chloor-2-fenylquinazoline |
Synoniemen |
AM-ex-OL |
Engelse naam |
4-Chloro-2-phenylquinazoline; AM-ex-OL |
MF |
C14H9ClN2 |
Molecuulgewicht |
240.6877 |
InChI |
InChI=1/C14H9ClN2/c15-13-11-8-4-5-9-12(11)16-14(17-13)10-6-2-1-3-7-10/h1-9H |
CAS-nummer |
6484-25-9 |
EINECS |
229-346-2 |
Moleculaire Structuur |
|
Dichtheid |
1.285g/cm3 |
Smeltpunt |
123-128℃ |
Kookpunt |
301.2°C at 760 mmHg |
Brekingsindex |
1.667 |
Vlampunt |
164.4°C |
Dampdruk |
0.00191mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|