65195-20-2 2-Piperidinophenol
Naam product |
2-Piperidinophenol |
Engelse naam |
2-Piperidinophenol; 2-(Piperidin-1-yl)phenol; phenol, 2-(1-piperidinyl)- |
MF |
C11H15NO |
Molecuulgewicht |
177.2429 |
InChI |
InChI=1/C11H15NO/c13-11-7-3-2-6-10(11)12-8-4-1-5-9-12/h2-3,6-7,13H,1,4-5,8-9H2 |
CAS-nummer |
65195-20-2 |
Moleculaire Structuur |
|
Dichtheid |
1.106g/cm3 |
Kookpunt |
296.8°C at 760 mmHg |
Brekingsindex |
1.575 |
Vlampunt |
145.3°C |
Dampdruk |
0.000795mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|