ChemNet > CAS > 652-29-9 2',3',4',5',6'-Pentafluoroacetophenone
652-29-9 2',3',4',5',6'-Pentafluoroacetophenone
Naam product |
2',3',4',5',6'-Pentafluoroacetophenone |
Engelse naam |
2',3',4',5',6'-Pentafluoroacetophenone; 2,3,4,5,6-Pentafluoroacetophenone; 1-(pentafluorophenyl)ethanone |
MF |
C8H3F5O |
Molecuulgewicht |
210.1008 |
InChI |
InChI=1/C8H3F5O/c1-2(14)3-4(9)6(11)8(13)7(12)5(3)10/h1H3 |
CAS-nummer |
652-29-9 |
EINECS |
211-487-6 |
Moleculaire Structuur |
|
Dichtheid |
1.479g/cm3 |
Kookpunt |
130.5°C at 760 mmHg |
Brekingsindex |
1.424 |
Vlampunt |
65.6°C |
Dampdruk |
9.68mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|