ChemNet > CAS > 652-32-4 2,3,5,6-tetrafluor-p-toluïnezuur
652-32-4 2,3,5,6-tetrafluor-p-toluïnezuur
Naam product |
2,3,5,6-tetrafluor-p-toluïnezuur |
Synoniemen |
2,3,5,6-tetrafluor-4-methylbenzoëzuur; 2,3,5,6-tetrafluor-4-methylbenzoaat |
Engelse naam |
2,3,5,6-Tetrafluoro-p-toluic acid; 2,3,5,6-Tetrafluoro-4-methylbenzoic acid; 2,3,5,6-tetrafluoro-4-methylbenzoate |
MF |
C8H3F4O2 |
Molecuulgewicht |
207.1024 |
InChI |
InChI=1/C8H4F4O2/c1-2-4(9)6(11)3(8(13)14)7(12)5(2)10/h1H3,(H,13,14)/p-1 |
CAS-nummer |
652-32-4 |
Moleculaire Structuur |
|
Smeltpunt |
168-175℃ |
Kookpunt |
255.8°C at 760 mmHg |
Vlampunt |
108.5°C |
Dampdruk |
0.00822mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|