Naam product |
Scopolamine hydrobromide trihydrate |
Engelse naam |
Scopolamine hydrobromide trihydrate; Atroscine hydrobromide trihydrate; Hyoscine hydrobromide trihydrate; 9-methyl-3-oxa-9-azatricyclo[3.3.1.0~2,4~]non-7-yl 3-hydroxy-2-phenylpropanoate; (1S,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.0~2,4~]non-7-yl 3-hydroxy-2-phenylpropanoate hydrobromide trihydrate; (1R,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.0~2,4~]non-7-yl (2S)-3-hydroxy-2-phenylpropanoate hydrobromide trihydrate; (1S,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.0~2,4~]non-7-yl (2S)-3-hydroxy-2-phenylpropanoatato hydrobromide trihydrate |
MF |
C17H28BrNO7 |
Molecuulgewicht |
438.3107 |
InChI |
InChI=1/C17H21NO4.BrH.3H2O/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10;;;;/h2-6,11-16,19H,7-9H2,1H3;1H;3*1H2/t11?,12-,13+,14+,15-,16+;;;;/m1..../s1 |
CAS-nummer |
6533-68-2 |
EINECS |
200-090-3 |
Moleculaire Structuur |
|
Smeltpunt |
197-194℃ |
Kookpunt |
460.3°C at 760 mmHg |
Vlampunt |
232.2°C |
Dampdruk |
2.87E-09mmHg at 25°C |
Gevaarsymbolen |
T+:Very toxic;
|
Risico-codes |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S1:Keep locked up.;
S25:Avoid contact with eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|