ChemNet > CAS > 65548-55-2 3',4',7,8-Tetramethoxyflavone
65548-55-2 3',4',7,8-Tetramethoxyflavone
Naam product |
3',4',7,8-Tetramethoxyflavone |
Engelse naam |
3',4',7,8-Tetramethoxyflavone;2-(3,4-dimethoxyphenyl)-7,8-dimethoxy-4H-chromen-4-one |
MF |
C19H18O6 |
Molecuulgewicht |
342.3426 |
InChI |
InChI=1/C19H18O6/c1-21-14-7-5-11(9-17(14)23-3)16-10-13(20)12-6-8-15(22-2)19(24-4)18(12)25-16/h5-10H,1-4H3 |
CAS-nummer |
65548-55-2 |
Moleculaire Structuur |
|
Dichtheid |
1.243g/cm3 |
Kookpunt |
512.1°C at 760 mmHg |
Brekingsindex |
1.574 |
Vlampunt |
226.3°C |
Dampdruk |
1.33E-10mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|