ChemNet > CAS > 6575-13-9 2,6-Dimethylbenzonitrile
6575-13-9 2,6-Dimethylbenzonitrile
| Naam product |
2,6-Dimethylbenzonitrile |
| Engelse naam |
2,6-Dimethylbenzonitrile; 2,6-Dimethylbenzoniitrile |
| MF |
C9H9N |
| Molecuulgewicht |
131.1745 |
| InChI |
InChI=1/C9H9N/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,1-2H3 |
| CAS-nummer |
6575-13-9 |
| EINECS |
229-503-5 |
| Moleculaire Structuur |
|
| Dichtheid |
0.99g/cm3 |
| Smeltpunt |
87-89℃ |
| Kookpunt |
228.7°C at 760 mmHg |
| Brekingsindex |
1.525 |
| Vlampunt |
91.9°C |
| Dampdruk |
0.0725mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|
