ChemNet > CAS > 6583-06-8 4-Nitro-2,1,3-benzothiadiazole
6583-06-8 4-Nitro-2,1,3-benzothiadiazole
| Naam product |
4-Nitro-2,1,3-benzothiadiazole |
| Engelse naam |
4-Nitro-2,1,3-benzothiadiazole; 4-Nitropiazthiole |
| MF |
C6H3N3O2S |
| Molecuulgewicht |
181.1719 |
| InChI |
InChI=1/C6H3N3O2S/c10-9(11)5-3-1-2-4-6(5)8-12-7-4/h1-3H |
| CAS-nummer |
6583-06-8 |
| EINECS |
229-514-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.627g/cm3 |
| Smeltpunt |
106-108℃ |
| Kookpunt |
314.3°C at 760 mmHg |
| Brekingsindex |
1.746 |
| Vlampunt |
143.9°C |
| Dampdruk |
0.000867mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
