ChemNet > CAS > 6586-05-6 New Methylene Blue N, zinc chloride doublesalt
6586-05-6 New Methylene Blue N, zinc chloride doublesalt
| Naam product |
New Methylene Blue N, zinc chloride doublesalt |
| Engelse naam |
New Methylene Blue N, zinc chloride doublesalt; |
| MF |
C18H22N3S |
| Molecuulgewicht |
312.4518 |
| InChI |
InChI=1/C18H21N3S/c1-5-19-13-9-17-15(7-11(13)3)21-16-8-12(4)14(20-6-2)10-18(16)22-17/h7-10,19H,5-6H2,1-4H3/p+1/b20-14+ |
| CAS-nummer |
6586-05-6 |
| EINECS |
229-516-6 |
| Moleculaire Structuur |
|
| Kookpunt |
440.9°C at 760 mmHg |
| Vlampunt |
220.5°C |
| Dampdruk |
5.67E-08mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
