ChemNet > CAS > 6587-24-2 methyl 2-cyanobenzoate
6587-24-2 methyl 2-cyanobenzoate
| Naam product |
methyl 2-cyanobenzoate |
| Engelse naam |
methyl 2-cyanobenzoate; |
| MF |
C9H7NO2 |
| Molecuulgewicht |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-5H,1H3 |
| CAS-nummer |
6587-24-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.18g/cm3 |
| Smeltpunt |
47℃ |
| Kookpunt |
295.8°C at 760 mmHg |
| Brekingsindex |
1.535 |
| Vlampunt |
136.2°C |
| Dampdruk |
0.00149mmHg at 25°C |
| Gevaarsymbolen |
 Xn:Harmful;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|
