ChemNet > CAS > 6609-54-7 2-(Methylthio)benzonitrile
6609-54-7 2-(Methylthio)benzonitrile
Naam product |
2-(Methylthio)benzonitrile |
Engelse naam |
2-(Methylthio)benzonitrile; 2-Cyanothioanisole~2-(Methylmercapto)benzonitrile; 2-(methylsulfanyl)benzonitrile |
MF |
C8H7NS |
Molecuulgewicht |
149.2129 |
InChI |
InChI=1/C8H7NS/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,1H3 |
CAS-nummer |
6609-54-7 |
Moleculaire Structuur |
|
Dichtheid |
1.14g/cm3 |
Kookpunt |
263.9°C at 760 mmHg |
Brekingsindex |
1.589 |
Vlampunt |
113.4°C |
Dampdruk |
0.00999mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|