ChemNet > CAS > 6640-09-1 5-Benzyloxyindole-2-carboxylic acid
6640-09-1 5-Benzyloxyindole-2-carboxylic acid
Naam product |
5-Benzyloxyindole-2-carboxylic acid |
Engelse naam |
5-Benzyloxyindole-2-carboxylic acid; 5-(Benzyloxy)-1H-indole-2-carboxylic acid |
MF |
C16H13NO3 |
Molecuulgewicht |
267.2793 |
InChI |
InChI=1/C16H13NO3/c18-16(19)15-9-12-8-13(6-7-14(12)17-15)20-10-11-4-2-1-3-5-11/h1-9,17H,10H2,(H,18,19) |
CAS-nummer |
6640-09-1 |
EINECS |
229-652-6 |
Moleculaire Structuur |
|
Dichtheid |
1.342g/cm3 |
Smeltpunt |
192℃ |
Kookpunt |
531.1°C at 760 mmHg |
Brekingsindex |
1.696 |
Vlampunt |
275°C |
Dampdruk |
4.13E-12mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|