ChemNet > CAS > 6670-13-9 4,5-Diphenyl-4-oxazoline-2-thione
6670-13-9 4,5-Diphenyl-4-oxazoline-2-thione
Naam product |
4,5-Diphenyl-4-oxazoline-2-thione |
Engelse naam |
4,5-Diphenyl-4-oxazoline-2-thione; 4,5-Diphenyl-2-oxazolethiol; 4,5-Diphenyl-2-mercaptooxazole; 4,5-diphenyl-1,3-oxazole-2(3H)-thione |
MF |
C15H11NOS |
Molecuulgewicht |
253.3189 |
InChI |
InChI=1/C15H11NOS/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H,16,18) |
CAS-nummer |
6670-13-9 |
EINECS |
229-707-4 |
Moleculaire Structuur |
|
Dichtheid |
1.31g/cm3 |
Smeltpunt |
256-260℃ |
Kookpunt |
390.6°C at 760 mmHg |
Brekingsindex |
1.708 |
Vlampunt |
190.1°C |
Dampdruk |
2.61E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|