ChemNet > CAS > 668-94-0 4,5-Diphenylimidazole
668-94-0 4,5-Diphenylimidazole
| Naam product |
4,5-Diphenylimidazole |
| Engelse naam |
4,5-Diphenylimidazole;4,5-Diphenyl-1H-imidazole; NSC 59776; 1H-Imidazole, 4,5-diphenyl- (9CI); Imidazole, 4,5-diphenyl- (8CI) |
| MF |
C15H12N2 |
| Molecuulgewicht |
220.2692 |
| InChI |
InChI=1/C15H12N2/c1-3-7-12(8-4-1)14-15(17-11-16-14)13-9-5-2-6-10-13/h1-11H,(H,16,17) |
| CAS-nummer |
668-94-0 |
| EINECS |
211-573-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.149g/cm3 |
| Smeltpunt |
229-233℃ |
| Kookpunt |
423.4°C at 760 mmHg |
| Brekingsindex |
1.627 |
| Vlampunt |
223.7°C |
| Dampdruk |
5.51E-07mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
