ChemNet > CAS > 67442-07-3 2-Chloro-N-methoxy-N-methylacetamide
67442-07-3 2-Chloro-N-methoxy-N-methylacetamide
Naam product |
2-Chloro-N-methoxy-N-methylacetamide |
Engelse naam |
2-Chloro-N-methoxy-N-methylacetamide; Acetamide, 2-chloro-N-methoxy-N-methyl-; N-Methyl-N-methoxy-2-chloroacetamide |
MF |
C4H8ClNO2 |
Molecuulgewicht |
137.5648 |
InChI |
InChI=1/C4H8ClNO2/c1-6(8-2)4(7)3-5/h3H2,1-2H3 |
CAS-nummer |
67442-07-3 |
Moleculaire Structuur |
|
Dichtheid |
1.178g/cm3 |
Smeltpunt |
39-41℃ |
Kookpunt |
141.5°C at 760 mmHg |
Brekingsindex |
1.442 |
Vlampunt |
39.4°C |
Dampdruk |
5.83mmHg at 25°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|