ChemNet > CAS > 67858-47-3 methyl 4-formyl-1-methyl-1H-pyrrole-2-carboxylate
67858-47-3 methyl 4-formyl-1-methyl-1H-pyrrole-2-carboxylate
Naam product |
methyl 4-formyl-1-methyl-1H-pyrrole-2-carboxylate |
Engelse naam |
methyl 4-formyl-1-methyl-1H-pyrrole-2-carboxylate; 4-Formyl-2-methoxycarbonyl-N-methylpyrrole; methyl 4-formyl-1H-pyrrole-2-carboxylate |
MF |
C8H9NO3 |
Molecuulgewicht |
167.162 |
InChI |
InChI=1/C8H9NO3/c1-9-4-6(5-10)3-7(9)8(11)12-2/h3-5H,1-2H3 |
CAS-nummer |
67858-47-3 |
Moleculaire Structuur |
|
Dichtheid |
1.16g/cm3 |
Smeltpunt |
96℃ |
Kookpunt |
293.1°C at 760 mmHg |
Brekingsindex |
1.521 |
Vlampunt |
131.1°C |
Dampdruk |
0.00176mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|