| Naam product |
l-glutaminezuur, N-coco-acylderivaten, compds.met triethanolamine (1:1) |
| Synoniemen |
L-glutaminezuur, N-coco-acylderivaten., compds.met triethanolamine; THEE-Cocoylglutamaat; Triethanolamine cocoylglutamaat; N-Cocoyl-L-glutaminezuur, mono(triethanolamine)zout; L-glutaminezuur, N-coco-acylderivaten., compds.met triethanolamine (1:1); l-Glutaminezuur, N-coco-acylderivaten., compds.with triethanolamine(1:1) |
| Engelse naam |
l-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine (1:1); L-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine; TEA-Cocoyl glutamate; Triethanolamine cocoyl glutamate; N-Cocoyl-L-glutamic acid, mono(triethanolamine) salt; L-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine (1:1); l-Glutamic acid, N-coco acyl derivs., compds. with triethanolamine(1:1); l-Glutamic acid,N-coco acyl derivs.,compds. with triethanolamine(1:1);
|
| MF |
C6H15NO3・C5H9NO4 |
| Molecuulgewicht |
296.318 |
| InChI |
InChI=1/C6H15NO3.C5H9NO4/c8-4-1-7(2-5-9)3-6-10;6-3(5(9)10)1-2-4(7)8/h8-10H,1-6H2;3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.0/s1 |
| CAS-nummer |
68187-29-1 |
| EINECS |
269-084-6 |
| Moleculaire Structuur |
|
|