ChemNet > CAS > 68208-19-5 3-Amino-3-(3-methoxyphenyl)propionic acid
68208-19-5 3-Amino-3-(3-methoxyphenyl)propionic acid
Naam product |
3-Amino-3-(3-methoxyphenyl)propionic acid |
Engelse naam |
3-Amino-3-(3-methoxyphenyl)propionic acid; (3S)-3-amino-3-(3-methoxyphenyl)propanoic acid; (3R)-3-amino-3-(3-methoxyphenyl)propanoic acid; 3-amino-3-(3-methoxyphenyl)propanoic acid |
MF |
C10H13NO3 |
Molecuulgewicht |
195.2151 |
InChI |
InChI=1/C10H13NO3/c1-14-8-4-2-3-7(5-8)9(11)6-10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13) |
CAS-nummer |
68208-19-5 |
Moleculaire Structuur |
|
Dichtheid |
1.206g/cm3 |
Kookpunt |
350.2°C at 760 mmHg |
Brekingsindex |
1.558 |
Vlampunt |
165.6°C |
Dampdruk |
1.66E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|