ChemNet > CAS > 68220-26-8 2-Chloro-6-fluorobenzyl bromide
68220-26-8 2-Chloro-6-fluorobenzyl bromide
| Naam product |
2-Chloro-6-fluorobenzyl bromide |
| Engelse naam |
2-Chloro-6-fluorobenzyl bromide; alpha-Bromo-2-chloro-6-fluorotoluene; 2-(bromomethyl)-1-chloro-3-fluorobenzene |
| MF |
C7H5BrClF |
| Molecuulgewicht |
223.47 |
| InChI |
InChI=1/C7H5BrClF/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
| CAS-nummer |
68220-26-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.654g/cm3 |
| Kookpunt |
222°C at 760 mmHg |
| Brekingsindex |
1.561 |
| Vlampunt |
88.1°C |
| Dampdruk |
0.155mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
