6836-19-7;6386-19-7 7-methoxy-1-tetralone
Naam product |
7-methoxy-1-tetralone |
Engelse naam |
7-methoxy-1-tetralone; 7-methoxy-1,2,3,4-tetrahydronaphthalen-1-one; 7-methoxyl-1-tetralone; 7-methoxy-3,4-dihydronaphthalen-1(2H)-one; 3,4-Dihydro-7-methoxy-1(2H)-naphthalenone; 7-Methoxy-1-Tetralone |
MF |
C11H12O2 |
Molecuulgewicht |
176.2118 |
InChI |
InChI=1/C11H12O2/c1-13-9-6-5-8-3-2-4-11(12)10(8)7-9/h5-7H,2-4H2,1H3 |
CAS-nummer |
6836-19-7;6386-19-7 |
EINECS |
229-916-0 |
Moleculaire Structuur |
|
Dichtheid |
1.124g/cm3 |
Smeltpunt |
59-63℃ |
Kookpunt |
312.3°C at 760 mmHg |
Brekingsindex |
1.548 |
Vlampunt |
145.8°C |
Dampdruk |
0.000535mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|