ChemNet > CAS > 68818-86-0 9,10-Diethoxyanthracene
68818-86-0 9,10-Diethoxyanthracene
Naam product |
9,10-Diethoxyanthracene |
Engelse naam |
9,10-Diethoxyanthracene;Anthracene, 9,10-diethoxy- |
MF |
C18H18O2 |
Molecuulgewicht |
266.3343 |
InChI |
InChI=1/C18H18O2/c1-3-19-17-13-9-5-7-11-15(13)18(20-4-2)16-12-8-6-10-14(16)17/h5-12H,3-4H2,1-2H3 |
CAS-nummer |
68818-86-0 |
EINECS |
272-401-0 |
Moleculaire Structuur |
|
Dichtheid |
1.115g/cm3 |
Smeltpunt |
148-151℃ |
Kookpunt |
433.2°C at 760 mmHg |
Brekingsindex |
1.626 |
Vlampunt |
176.4°C |
Dampdruk |
2.65E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|