ChemNet > CAS > 402-61-9;696-22-0 1H-Pyrazole-3-carboxylicacid, 5-methyl-
402-61-9;696-22-0 1H-Pyrazole-3-carboxylicacid, 5-methyl-
| Naam product |
1H-Pyrazole-3-carboxylicacid, 5-methyl- |
| Engelse naam |
1H-Pyrazole-3-carboxylicacid, 5-methyl-; 3-methyl-1H-pyrazole-5-carboxylic acid; 5-Methyl-1H-pyrazole-3-carboxylic acid; 5-methylpyrazole-3-carboxylic acid; 5-methyl-1h-pyrazole-3-carboxylic acid;
|
| MF |
C5H6N2O2 |
| Molecuulgewicht |
126.11 |
| InChI |
InChI=1/C5H6N2O2/c1-3-2-4(5(8)9)7-6-3/h2H,1H3,(H,6,7)(H,8,9) |
| CAS-nummer |
402-61-9;696-22-0 |
| EINECS |
206-953-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.404 g/cm3 |
| Kookpunt |
388.8 °C at 760 mmHg |
| Brekingsindex |
1.595 |
| Vlampunt |
188.9 °C |
| Dampdruk |
9.69E-07mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
