ChemNet > CAS > 702-23-8 4-Methoxyphenethyl alcohol
702-23-8 4-Methoxyphenethyl alcohol
Naam product |
4-Methoxyphenethyl alcohol |
Engelse naam |
4-Methoxyphenethyl alcohol; p-Methoxyphenethyl alcohol; 2-(4-Methoxyphenyl)ethanol; p-Methoxyphenylethanol |
MF |
C9H12O2 |
Molecuulgewicht |
152.1904 |
InChI |
InChI=1/C9H12O2/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5,10H,6-7H2,1H3 |
CAS-nummer |
702-23-8 |
EINECS |
211-866-6 |
Moleculaire Structuur |
|
Dichtheid |
1.058g/cm3 |
Smeltpunt |
28℃ |
Kookpunt |
257.5°C at 760 mmHg |
Brekingsindex |
1.524 |
Vlampunt |
110.2°C |
Dampdruk |
0.00745mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|